C31H37ClF3N7O5S — CID 169172364
tert-butyl N-[3-[[4-[[5-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonyl-2-pyridinyl]carbamoyl]phenyl]methylamino]propyl]carbamate (PubChem CID 169172364) has the molecular formula C31H37ClF3N7O5S and a molecular weight of 712.19 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-[[5-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonyl-2-pyridinyl]carbamoyl]phenyl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-[[5-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonyl-2-pyridinyl]carbamoyl]phenyl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 169172364 |
| Molecular Formula | C31H37ClF3N7O5S |
| Molecular Weight | 712.19 g/mol |
| Exact Mass | 711.22 |
| IUPAC Name | tert-butyl N-[3-[[4-[[5-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonyl-2-pyridinyl]carbamoyl]phenyl]methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNCc1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCN(c4cc(C(F)(F)F)cc(Cl)n4)CC3)cn2)cc1 |
| InChI | InChI=1S/C31H37ClF3N7O5S/c1-30(2,3)47-29(44)37-12-4-11-36-19-21-5-7-22(8-6-21)28(43)40-26-10-9-24(20-38-26)48(45,46)42-15-13-41(14-16-42)27-18-23(31(33,34)35)17-25(32)39-27/h5-10,17-18,20,36H,4,11-16,19H2,1-3H3,(H,37,44)(H,38,40,43) |
| InChIKey | GQTZPADEAMLVDF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.19 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|