C25H26ClF6N5O5S — CID 149433294
tert-butyl N-[5-[(3S)-4-[3-chloro-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]-3-prop-1-ynylpiperazin-1-yl]sulfonyl-2-pyridinyl]carbamate (PubChem CID 149433294) has the molecular formula C25H26ClF6N5O5S and a molecular weight of 658.02 g/mol. Its IUPAC name is tert-butyl N-[5-[(3S)-4-[3-chloro-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]-3-prop-1-ynylpiperazin-1-yl]sulfonyl-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[(3S)-4-[3-chloro-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]-3-prop-1-ynylpiperazin-1-yl]sulfonyl-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 149433294 |
| Molecular Formula | C25H26ClF6N5O5S |
| Molecular Weight | 658.02 g/mol |
| Exact Mass | 657.12 |
| IUPAC Name | tert-butyl N-[5-[(3S)-4-[3-chloro-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]-3-prop-1-ynylpiperazin-1-yl]sulfonyl-2-pyridinyl]carbamate |
| SMILES | CC#C[C@H]1CN(S(=O)(=O)c2ccc(NC(=O)OC(C)(C)C)nc2)CCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C25H26ClF6N5O5S/c1-5-6-16-14-36(43(40,41)17-7-8-19(33-13-17)35-21(38)42-22(2,3)4)9-10-37(16)20-18(26)11-15(12-34-20)23(39,24(27,28)29)25(30,31)32/h7-8,11-13,16,39H,9-10,14H2,1-4H3,(H,33,35,38)/t16-/m0/s1 |
| InChIKey | IJCQEWNKTIVMEI-INIZCTEOSA-N |
| XLogP | 4.69 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.02 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|