C26H30F3N7O5S — CID 90065428
tert-butyl N-[5-[(3S)-4-[4-(3-azido-1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfonyl-2-pyridinyl]carbamate (PubChem CID 90065428) has the molecular formula C26H30F3N7O5S and a molecular weight of 609.63 g/mol. Its IUPAC name is tert-butyl N-[5-[(3S)-4-[4-(3-azido-1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfonyl-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[(3S)-4-[4-(3-azido-1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfonyl-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 90065428 |
| Molecular Formula | C26H30F3N7O5S |
| Molecular Weight | 609.63 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | tert-butyl N-[5-[(3S)-4-[4-(3-azido-1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfonyl-2-pyridinyl]carbamate |
| SMILES | CC#C[C@H]1CN(S(=O)(=O)c2ccc(NC(=O)OC(C)(C)C)nc2)CCN1c1ccc(C(O)(CN=[N+]=[N-])C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H30F3N7O5S/c1-5-6-20-16-35(42(39,40)21-11-12-22(31-15-21)33-23(37)41-24(2,3)4)13-14-36(20)19-9-7-18(8-10-19)25(38,17-32-34-30)26(27,28)29/h7-12,15,20,38H,13-14,16-17H2,1-4H3,(H,31,33,37)/t20-,25?/m0/s1 |
| InChIKey | TYQBQOSIEGKIJF-JINQPTGOSA-N |
| XLogP | 4.39 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|