C27H39N5O2S2 — CID 144584356
tert-butyl N-[5-[4-[4-(dimethylaminosulfanyl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfanyl-2-pyridinyl]carbamate;ethane (PubChem CID 144584356) has the molecular formula C27H39N5O2S2 and a molecular weight of 529.78 g/mol. Its IUPAC name is tert-butyl N-[5-[4-[4-(dimethylaminosulfanyl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfanyl-2-pyridinyl]carbamate;ethane.
| Compound Name | tert-butyl N-[5-[4-[4-(dimethylaminosulfanyl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfanyl-2-pyridinyl]carbamate;ethane |
|---|---|
| PubChem CID | 144584356 |
| Molecular Formula | C27H39N5O2S2 |
| Molecular Weight | 529.78 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | tert-butyl N-[5-[4-[4-(dimethylaminosulfanyl)phenyl]-3-prop-1-ynylpiperazin-1-yl]sulfanyl-2-pyridinyl]carbamate;ethane |
| SMILES | CC.CC#CC1CN(Sc2ccc(NC(=O)OC(C)(C)C)nc2)CCN1c1ccc(SN(C)C)cc1 |
| InChI | InChI=1S/C25H33N5O2S2.C2H6/c1-7-8-20-18-29(15-16-30(20)19-9-11-21(12-10-19)33-28(5)6)34-22-13-14-23(26-17-22)27-24(31)32-25(2,3)4;1-2/h9-14,17,20H,15-16,18H2,1-6H3,(H,26,27,31);1-2H3 |
| InChIKey | RQHSISMCMLZYPL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.78 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|