C19H24N6O3S — CID 70659898
2-[2-[4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]pyrimidin-5-yl]propan-2-ol (PubChem CID 70659898) has the molecular formula C19H24N6O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[2-[4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]pyrimidin-5-yl]propan-2-ol.
| Compound Name | 2-[2-[4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]pyrimidin-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 70659898 |
| Molecular Formula | C19H24N6O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[2-[4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]pyrimidin-5-yl]propan-2-ol |
| SMILES | CC#CC1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ncc(C(C)(C)O)cn1 |
| InChI | InChI=1S/C19H24N6O3S/c1-4-5-15-13-24(29(27,28)16-6-7-17(20)21-12-16)8-9-25(15)18-22-10-14(11-23-18)19(2,3)26/h6-7,10-12,15,26H,8-9,13H2,1-3H3,(H2,20,21) |
| InChIKey | HTVMNNVHMDPLAX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|