C20H21F3N4O3S2 — CID 88876800
2-[(3S)-3-prop-1-ynyl-4-[5-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]pyrimidin-2-yl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 88876800) has the molecular formula C20H21F3N4O3S2 and a molecular weight of 486.54 g/mol. Its IUPAC name is 2-[(3S)-3-prop-1-ynyl-4-[5-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]pyrimidin-2-yl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
| Compound Name | 2-[(3S)-3-prop-1-ynyl-4-[5-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]pyrimidin-2-yl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 88876800 |
| Molecular Formula | C20H21F3N4O3S2 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-[(3S)-3-prop-1-ynyl-4-[5-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]pyrimidin-2-yl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | CC#C[C@H]1CN(S(=O)(=O)C2=CC=CCC2=S)CCN1c1ncc([C@@](C)(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H21F3N4O3S2/c1-3-6-15-13-26(32(29,30)17-8-5-4-7-16(17)31)9-10-27(15)18-24-11-14(12-25-18)19(2,28)20(21,22)23/h4-5,8,11-12,15,28H,7,9-10,13H2,1-2H3/t15-,19+/m0/s1 |
| InChIKey | GBYGJGCZZUFCKI-HNAYVOBHSA-N |
| XLogP | 2.30 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|