C18H22N4O3S2 — CID 70659774
2-[2-[(2R)-2-prop-1-ynyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]pyrimidin-5-yl]propan-2-ol (PubChem CID 70659774) has the molecular formula C18H22N4O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[2-[(2R)-2-prop-1-ynyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]pyrimidin-5-yl]propan-2-ol.
| Compound Name | 2-[2-[(2R)-2-prop-1-ynyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]pyrimidin-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 70659774 |
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-[2-[(2R)-2-prop-1-ynyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]pyrimidin-5-yl]propan-2-ol |
| SMILES | CC#C[C@@H]1CN(S(=O)(=O)c2cccs2)CCN1c1ncc(C(C)(C)O)cn1 |
| InChI | InChI=1S/C18H22N4O3S2/c1-4-6-15-13-21(27(24,25)16-7-5-10-26-16)8-9-22(15)17-19-11-14(12-20-17)18(2,3)23/h5,7,10-12,15,23H,8-9,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | XQINVCZPKPUDRU-OAHLLOKOSA-N |
| XLogP | 1.67 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|