C18H18F4N2O2S — CID 100695438
1-(4-fluoro-3-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 100695438) has the molecular formula C18H18F4N2O2S and a molecular weight of 402.41 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-(4-fluoro-3-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 100695438 |
| Molecular Formula | C18H18F4N2O2S |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)ccc1F |
| InChI | InChI=1S/C18H18F4N2O2S/c1-13-11-16(5-6-17(13)19)27(25,26)24-9-7-23(8-10-24)15-4-2-3-14(12-15)18(20,21)22/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | JKJPJZANARUEOL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |