C16H26N4O6S3 — CID 55621350
1-methyl-4-[4-(3-methylsulfonylphenyl)sulfonylpiperazin-1-yl]sulfonylpiperazine (PubChem CID 55621350) has the molecular formula C16H26N4O6S3 and a molecular weight of 466.61 g/mol. Its IUPAC name is 1-methyl-4-[4-(3-methylsulfonylphenyl)sulfonylpiperazin-1-yl]sulfonylpiperazine.
| Compound Name | 1-methyl-4-[4-(3-methylsulfonylphenyl)sulfonylpiperazin-1-yl]sulfonylpiperazine |
|---|---|
| PubChem CID | 55621350 |
| Molecular Formula | C16H26N4O6S3 |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 1-methyl-4-[4-(3-methylsulfonylphenyl)sulfonylpiperazin-1-yl]sulfonylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)N2CCN(S(=O)(=O)c3cccc(S(C)(=O)=O)c3)CC2)CC1 |
| InChI | InChI=1S/C16H26N4O6S3/c1-17-6-8-19(9-7-17)29(25,26)20-12-10-18(11-13-20)28(23,24)16-5-3-4-15(14-16)27(2,21)22/h3-5,14H,6-13H2,1-2H3 |
| InChIKey | VIBJGAGXLFETSI-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 115.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |