C21H21ClN4OS — CID 37200842
[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone (PubChem CID 37200842) has the molecular formula C21H21ClN4OS and a molecular weight of 412.95 g/mol. Its IUPAC name is [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone.
| Compound Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
|---|---|
| PubChem CID | 37200842 |
| Molecular Formula | C21H21ClN4OS |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
| SMILES | O=C(c1c[nH]c(=S)n1-c1ccccc1)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H21ClN4OS/c22-17-6-4-5-16(13-17)15-24-9-11-25(12-10-24)20(27)19-14-23-21(28)26(19)18-7-2-1-3-8-18/h1-8,13-14H,9-12,15H2,(H,23,28) |
| InChIKey | CFRXFCJZTHEDTB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|