C24H23N5O2S — CID 55860738
2-(1H-indol-3-yl)-1-[4-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)piperazin-1-yl]ethanone (PubChem CID 55860738) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-1-[4-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1H-indol-3-yl)-1-[4-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55860738 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-(1H-indol-3-yl)-1-[4-(3-phenyl-2-sulfanylidene-1H-imidazole-4-carbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N1CCN(C(=O)c2c[nH]c(=S)n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C24H23N5O2S/c30-22(14-17-15-25-20-9-5-4-8-19(17)20)27-10-12-28(13-11-27)23(31)21-16-26-24(32)29(21)18-6-2-1-3-7-18/h1-9,15-16,25H,10-14H2,(H,26,32) |
| InChIKey | BZFCZBLSBUZUIW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|