C16H19N3OS — CID 18108153
azepan-1-yl-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone (PubChem CID 18108153) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is azepan-1-yl-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone.
| Compound Name | azepan-1-yl-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
|---|---|
| PubChem CID | 18108153 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | azepan-1-yl-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
| SMILES | O=C(c1c[nH]c(=S)n1-c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C16H19N3OS/c20-15(18-10-6-1-2-7-11-18)14-12-17-16(21)19(14)13-8-4-3-5-9-13/h3-5,8-9,12H,1-2,6-7,10-11H2,(H,17,21) |
| InChIKey | SXFBQCBWXGRSTN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|