C18H15N3OS — CID 18165364
2,3-dihydroindol-1-yl-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone (PubChem CID 18165364) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
|---|---|
| PubChem CID | 18165364 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2,3-dihydroindol-1-yl-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
| SMILES | O=C(c1c[nH]c(=S)n1-c1ccccc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H15N3OS/c22-17(20-11-10-13-6-4-5-9-15(13)20)16-12-19-18(23)21(16)14-7-2-1-3-8-14/h1-9,12H,10-11H2,(H,19,23) |
| InChIKey | CWCXPGOQHAZNMO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|