C22H20FN5OS — CID 24543608
4-[[4-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carbonyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 24543608) has the molecular formula C22H20FN5OS and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[[4-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carbonyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carbonyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 24543608 |
| Molecular Formula | C22H20FN5OS |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 4-[[4-[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carbonyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCN(C(=O)c3c[nH]c(=S)n3-c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H20FN5OS/c23-18-5-7-19(8-6-18)28-20(14-25-22(28)30)21(29)27-11-9-26(10-12-27)15-17-3-1-16(13-24)2-4-17/h1-8,14H,9-12,15H2,(H,25,30) |
| InChIKey | OYMZVMKGGNLIPC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|