C17H20N2O4S2 — CID 75463156
[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-(4-hydroxythiophen-2-yl)methanone (PubChem CID 75463156) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is [4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-(4-hydroxythiophen-2-yl)methanone.
| Compound Name | [4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-(4-hydroxythiophen-2-yl)methanone |
|---|---|
| PubChem CID | 75463156 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-(4-hydroxythiophen-2-yl)methanone |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(C(=O)c3cc(O)cs3)CC2)c1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-12-3-4-13(2)16(9-12)25(22,23)19-7-5-18(6-8-19)17(21)15-10-14(20)11-24-15/h3-4,9-11,20H,5-8H2,1-2H3 |
| InChIKey | ROFAYQKOFYVTMQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|