C19H21N5O3S — CID 24535867
2H-benzotriazol-5-yl-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 24535867) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is 2H-benzotriazol-5-yl-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | 2H-benzotriazol-5-yl-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24535867 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2H-benzotriazol-5-yl-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(C(=O)c3ccc4n[nH]nc4c3)CC2)c1 |
| InChI | InChI=1S/C19H21N5O3S/c1-13-3-4-14(2)18(11-13)28(26,27)24-9-7-23(8-10-24)19(25)15-5-6-16-17(12-15)21-22-20-16/h3-6,11-12H,7-10H2,1-2H3,(H,20,21,22) |
| InChIKey | FDQBEJSRYJZYIC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |