C18H16FN3OS — CID 17449995
N-(3-ethylphenyl)-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 17449995) has the molecular formula C18H16FN3OS and a molecular weight of 341.41 g/mol. Its IUPAC name is N-(3-ethylphenyl)-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-(3-ethylphenyl)-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 17449995 |
| Molecular Formula | C18H16FN3OS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(3-ethylphenyl)-3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | CCc1cccc(NC(=O)c2c[nH]c(=S)n2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H16FN3OS/c1-2-12-4-3-5-14(10-12)21-17(23)16-11-20-18(24)22(16)15-8-6-13(19)7-9-15/h3-11H,2H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | FYHWYPHLMPGZAG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|