C19H17FN4O2S2 — CID 24553823
3-(4-fluorophenyl)-2-sulfanylidene-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1H-imidazole-4-carbohydrazide (PubChem CID 24553823) has the molecular formula C19H17FN4O2S2 and a molecular weight of 416.50 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-sulfanylidene-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1H-imidazole-4-carbohydrazide.
| Compound Name | 3-(4-fluorophenyl)-2-sulfanylidene-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1H-imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24553823 |
| Molecular Formula | C19H17FN4O2S2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 3-(4-fluorophenyl)-2-sulfanylidene-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1H-imidazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1c[nH]c(=S)n1-c1ccc(F)cc1)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H17FN4O2S2/c20-12-5-7-13(8-6-12)24-14(10-21-19(24)27)17(25)22-23-18(26)16-9-11-3-1-2-4-15(11)28-16/h5-10H,1-4H2,(H,21,27)(H,22,25)(H,23,26) |
| InChIKey | MSFLUZHOFKWMRO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|