C19H18N4O2S2 — CID 24553824
3-phenyl-2-sulfanylidene-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1H-imidazole-4-carbohydrazide (PubChem CID 24553824) has the molecular formula C19H18N4O2S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-phenyl-2-sulfanylidene-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1H-imidazole-4-carbohydrazide.
| Compound Name | 3-phenyl-2-sulfanylidene-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1H-imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24553824 |
| Molecular Formula | C19H18N4O2S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 3-phenyl-2-sulfanylidene-N'-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-1H-imidazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1c[nH]c(=S)n1-c1ccccc1)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H18N4O2S2/c24-17(14-11-20-19(26)23(14)13-7-2-1-3-8-13)21-22-18(25)16-10-12-6-4-5-9-15(12)27-16/h1-3,7-8,10-11H,4-6,9H2,(H,20,26)(H,21,24)(H,22,25) |
| InChIKey | DNYRKSWCAYHZQN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|