C10H7N2O2S- — CID 7063948
3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxylate (PubChem CID 7063948) has the molecular formula C10H7N2O2S- and a molecular weight of 219.25 g/mol. Its IUPAC name is 3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxylate.
| Compound Name | 3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 7063948 |
| Molecular Formula | C10H7N2O2S- |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxylate |
| SMILES | O=C([O-])c1c[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C10H8N2O2S/c13-9(14)8-6-11-10(15)12(8)7-4-2-1-3-5-7/h1-6H,(H,11,15)(H,13,14)/p-1 |
| InChIKey | YXIZTCTXXDBABW-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|