C22H22N4O3S — CID 31846426
6-methyl-4-oxo-1-phenyl-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)pyridazine-3-carbohydrazide (PubChem CID 31846426) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 6-methyl-4-oxo-1-phenyl-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)pyridazine-3-carbohydrazide.
| Compound Name | 6-methyl-4-oxo-1-phenyl-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)pyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 31846426 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 6-methyl-4-oxo-1-phenyl-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)pyridazine-3-carbohydrazide |
| SMILES | Cc1cc(=O)c(C(=O)NNC(=O)c2cc3c(s2)CCCCC3)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-14-12-17(27)20(25-26(14)16-9-5-3-6-10-16)22(29)24-23-21(28)19-13-15-8-4-2-7-11-18(15)30-19/h3,5-6,9-10,12-13H,2,4,7-8,11H2,1H3,(H,23,28)(H,24,29) |
| InChIKey | NEVBIVKHRDVZIG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|