C19H15ClN4O3 — CID 9086701
N'-(3-chlorobenzoyl)-6-methyl-4-oxo-1-phenylpyridazine-3-carbohydrazide (PubChem CID 9086701) has the molecular formula C19H15ClN4O3 and a molecular weight of 382.81 g/mol. Its IUPAC name is N'-(3-chlorobenzoyl)-6-methyl-4-oxo-1-phenylpyridazine-3-carbohydrazide.
| Compound Name | N'-(3-chlorobenzoyl)-6-methyl-4-oxo-1-phenylpyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 9086701 |
| Molecular Formula | C19H15ClN4O3 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N'-(3-chlorobenzoyl)-6-methyl-4-oxo-1-phenylpyridazine-3-carbohydrazide |
| SMILES | Cc1cc(=O)c(C(=O)NNC(=O)c2cccc(Cl)c2)nn1-c1ccccc1 |
| InChI | InChI=1S/C19H15ClN4O3/c1-12-10-16(25)17(23-24(12)15-8-3-2-4-9-15)19(27)22-21-18(26)13-6-5-7-14(20)11-13/h2-11H,1H3,(H,21,26)(H,22,27) |
| InChIKey | XIAHYAOCSICGHS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|