C20H19ClN4O3S — CID 26926496
1-(4-chlorophenyl)-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-6-methyl-4-oxopyridazine-3-carbohydrazide (PubChem CID 26926496) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-6-methyl-4-oxopyridazine-3-carbohydrazide.
| Compound Name | 1-(4-chlorophenyl)-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-6-methyl-4-oxopyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 26926496 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-6-methyl-4-oxopyridazine-3-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)c2nn(-c3ccc(Cl)cc3)c(C)cc2=O)cc1C |
| InChI | InChI=1S/C20H19ClN4O3S/c1-4-16-11(2)9-17(29-16)19(27)22-23-20(28)18-15(26)10-12(3)25(24-18)14-7-5-13(21)6-8-14/h5-10H,4H2,1-3H3,(H,22,27)(H,23,28) |
| InChIKey | NGSWFFOBWSWTRN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|