C19H24ClN3O2 — CID 46515956
1-(4-chlorophenyl)-6-methyl-N-(5-methylhexan-2-yl)-4-oxopyridazine-3-carboxamide (PubChem CID 46515956) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-methyl-N-(5-methylhexan-2-yl)-4-oxopyridazine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-6-methyl-N-(5-methylhexan-2-yl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 46515956 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-(4-chlorophenyl)-6-methyl-N-(5-methylhexan-2-yl)-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NC(C)CCC(C)C)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-12(2)5-6-13(3)21-19(25)18-17(24)11-14(4)23(22-18)16-9-7-15(20)8-10-16/h7-13H,5-6H2,1-4H3,(H,21,25) |
| InChIKey | ADPQHKCSPSIPLT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |