C19H19ClN6O3 — CID 9088610
1-(4-chlorophenyl)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-6-methyl-4-oxopyridazine-3-carbohydrazide (PubChem CID 9088610) has the molecular formula C19H19ClN6O3 and a molecular weight of 414.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-6-methyl-4-oxopyridazine-3-carbohydrazide.
| Compound Name | 1-(4-chlorophenyl)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-6-methyl-4-oxopyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 9088610 |
| Molecular Formula | C19H19ClN6O3 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-6-methyl-4-oxopyridazine-3-carbohydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)c2nn(-c3ccc(Cl)cc3)c(C)cc2=O)n1 |
| InChI | InChI=1S/C19H19ClN6O3/c1-11-8-12(2)25(23-11)10-17(28)21-22-19(29)18-16(27)9-13(3)26(24-18)15-6-4-14(20)5-7-15/h4-9H,10H2,1-3H3,(H,21,28)(H,22,29) |
| InChIKey | OBBJSZYZEIOJLW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|