C23H18N2O5S4 — CID 11577357
N-[2-(1-benzothiophen-2-ylsulfonylamino)-4-methoxyphenyl]-1-benzothiophene-2-sulfonamide (PubChem CID 11577357) has the molecular formula C23H18N2O5S4 and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-2-ylsulfonylamino)-4-methoxyphenyl]-1-benzothiophene-2-sulfonamide.
| Compound Name | N-[2-(1-benzothiophen-2-ylsulfonylamino)-4-methoxyphenyl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11577357 |
| Molecular Formula | C23H18N2O5S4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | N-[2-(1-benzothiophen-2-ylsulfonylamino)-4-methoxyphenyl]-1-benzothiophene-2-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc3ccccc3s2)c(NS(=O)(=O)c2cc3ccccc3s2)c1 |
| InChI | InChI=1S/C23H18N2O5S4/c1-30-17-10-11-18(24-33(26,27)22-12-15-6-2-4-8-20(15)31-22)19(14-17)25-34(28,29)23-13-16-7-3-5-9-21(16)32-23/h2-14,24-25H,1H3 |
| InChIKey | LQKWZEMEFNRWIG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |