C20H17N3O5S3 — CID 56646090
N-[3-[(4-methoxyphenyl)sulfonylamino]-2-pyridinyl]-1-benzothiophene-2-sulfonamide (PubChem CID 56646090) has the molecular formula C20H17N3O5S3 and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[3-[(4-methoxyphenyl)sulfonylamino]-2-pyridinyl]-1-benzothiophene-2-sulfonamide.
| Compound Name | N-[3-[(4-methoxyphenyl)sulfonylamino]-2-pyridinyl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 56646090 |
| Molecular Formula | C20H17N3O5S3 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | N-[3-[(4-methoxyphenyl)sulfonylamino]-2-pyridinyl]-1-benzothiophene-2-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccnc2NS(=O)(=O)c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H17N3O5S3/c1-28-15-8-10-16(11-9-15)30(24,25)22-17-6-4-12-21-20(17)23-31(26,27)19-13-14-5-2-3-7-18(14)29-19/h2-13,22H,1H3,(H,21,23) |
| InChIKey | KLLPARNHHGMSQN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |