C21H23N3O6S — CID 15293874
4-methoxy-N-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]benzenesulfonamide (PubChem CID 15293874) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-methoxy-N-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 15293874 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-methoxy-N-[2-(3,4,5-trimethoxyanilino)-3-pyridinyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccnc2Nc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H23N3O6S/c1-27-15-7-9-16(10-8-15)31(25,26)24-17-6-5-11-22-21(17)23-14-12-18(28-2)20(30-4)19(13-14)29-3/h5-13,24H,1-4H3,(H,22,23) |
| InChIKey | BTMDFFFQKCUGDO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |