C18H17N3O7S2 — CID 15294822
[4-[[3-[(4-methoxyphenyl)sulfonylamino]-2-pyridinyl]amino]phenyl] hydrogen sulfate (PubChem CID 15294822) has the molecular formula C18H17N3O7S2 and a molecular weight of 451.48 g/mol. Its IUPAC name is [4-[[3-[(4-methoxyphenyl)sulfonylamino]-2-pyridinyl]amino]phenyl] hydrogen sulfate.
| Compound Name | [4-[[3-[(4-methoxyphenyl)sulfonylamino]-2-pyridinyl]amino]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 15294822 |
| Molecular Formula | C18H17N3O7S2 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | [4-[[3-[(4-methoxyphenyl)sulfonylamino]-2-pyridinyl]amino]phenyl] hydrogen sulfate |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccnc2Nc2ccc(OS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O7S2/c1-27-14-8-10-16(11-9-14)29(22,23)21-17-3-2-12-19-18(17)20-13-4-6-15(7-5-13)28-30(24,25)26/h2-12,21H,1H3,(H,19,20)(H,24,25,26) |
| InChIKey | DVCWKDSYSZFIIE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|