C22H15BrN2O4S4 — CID 11505180
N-[2-(1-benzothiophen-2-ylsulfonylamino)-4-bromophenyl]-1-benzothiophene-2-sulfonamide (PubChem CID 11505180) has the molecular formula C22H15BrN2O4S4 and a molecular weight of 579.54 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-2-ylsulfonylamino)-4-bromophenyl]-1-benzothiophene-2-sulfonamide.
| Compound Name | N-[2-(1-benzothiophen-2-ylsulfonylamino)-4-bromophenyl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11505180 |
| Molecular Formula | C22H15BrN2O4S4 |
| Molecular Weight | 579.54 g/mol |
| Exact Mass | 577.91 |
| IUPAC Name | N-[2-(1-benzothiophen-2-ylsulfonylamino)-4-bromophenyl]-1-benzothiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)cc1NS(=O)(=O)c1cc2ccccc2s1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C22H15BrN2O4S4/c23-16-9-10-17(24-32(26,27)21-11-14-5-1-3-7-19(14)30-21)18(13-16)25-33(28,29)22-12-15-6-2-4-8-20(15)31-22/h1-13,24-25H |
| InChIKey | KWWQLKCQXIVZNJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |