C23H17Cl2F3N2O5S3 — CID 11671771
N-[2-[[5-(1,1-dichloro-2,2,2-trifluoroethyl)-2-methoxyphenyl]sulfonylamino]phenyl]-1-benzothiophene-2-sulfonamide (PubChem CID 11671771) has the molecular formula C23H17Cl2F3N2O5S3 and a molecular weight of 625.50 g/mol. Its IUPAC name is N-[2-[[5-(1,1-dichloro-2,2,2-trifluoroethyl)-2-methoxyphenyl]sulfonylamino]phenyl]-1-benzothiophene-2-sulfonamide.
| Compound Name | N-[2-[[5-(1,1-dichloro-2,2,2-trifluoroethyl)-2-methoxyphenyl]sulfonylamino]phenyl]-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11671771 |
| Molecular Formula | C23H17Cl2F3N2O5S3 |
| Molecular Weight | 625.50 g/mol |
| Exact Mass | 623.96 |
| IUPAC Name | N-[2-[[5-(1,1-dichloro-2,2,2-trifluoroethyl)-2-methoxyphenyl]sulfonylamino]phenyl]-1-benzothiophene-2-sulfonamide |
| SMILES | COc1ccc(C(Cl)(Cl)C(F)(F)F)cc1S(=O)(=O)Nc1ccccc1NS(=O)(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C23H17Cl2F3N2O5S3/c1-35-18-11-10-15(22(24,25)23(26,27)28)13-20(18)37(31,32)29-16-7-3-4-8-17(16)30-38(33,34)21-12-14-6-2-5-9-19(14)36-21/h2-13,29-30H,1H3 |
| InChIKey | GEFVQDNTTFSKTD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|