About 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid
2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid (PubChem CID 62904172) has the molecular formula C10H10N2O6S
and a molecular weight of 286.26 g/mol. Its IUPAC name is 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid.
Molecular Properties
| Compound Name | 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid |
| PubChem CID | 62904172 |
| Molecular Formula | C10H10N2O6S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid |
| SMILES | Cc1oc(C)c(S(=O)(=O)Nc2cnoc2)c1C(=O)O |
| InChI | InChI=1S/C10H10N2O6S/c1-5-8(10(13)14)9(6(2)18-5)19(15,16)12-7-3-11-17-4-7/h3-4,12H,1-2H3,(H,13,14) |
| InChIKey | GQSCXMQFKPGWLL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid?
The IUPAC name of 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid (CID 62904172) is 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid.
What is the SMILES notation for 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid?
The canonical SMILES for 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid is Cc1oc(C)c(S(=O)(=O)Nc2cnoc2)c1C(=O)O.
What is the InChIKey of 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid?
The InChIKey is GQSCXMQFKPGWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O6S/c1-5-8(10(13)14)9(6(2)18-5)19(15,16)12-7-3-11-17-4-7/h3-4,12H,1-2H3,(H,13,14).
What are the key properties of 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid?
2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid has a molecular weight of 286.26 g/mol, XLogP of 1.38, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-(1,2-oxazol-4-ylsulfamoyl)furan-3-carboxylic acid is sourced from PubChem (CID 62904172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).