C10H10N2O5S2 — CID 43319867
2,5-dimethyl-4-(1,3-thiazol-2-ylsulfamoyl)furan-3-carboxylic acid (PubChem CID 43319867) has the molecular formula C10H10N2O5S2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2,5-dimethyl-4-(1,3-thiazol-2-ylsulfamoyl)furan-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-4-(1,3-thiazol-2-ylsulfamoyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 43319867 |
| Molecular Formula | C10H10N2O5S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 2,5-dimethyl-4-(1,3-thiazol-2-ylsulfamoyl)furan-3-carboxylic acid |
| SMILES | Cc1oc(C)c(S(=O)(=O)Nc2nccs2)c1C(=O)O |
| InChI | InChI=1S/C10H10N2O5S2/c1-5-7(9(13)14)8(6(2)17-5)19(15,16)12-10-11-3-4-18-10/h3-4H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | UYOXXJSIVQAAQI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |