3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid

C10H7FN2O5S — CID 79040867

IUPAC3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid
SMILESO=C(O)c1ccc(S(=O)(=O)Nc2cnoc2)c(F)c1
InChIInChI=1S/C10H7FN2O5S/c11-8-3-6(10(14)15)1-2-9(8)19(16,17)13-7-4-12-18-5-7/h1-5,13H,(H,14,15)
InChIKeyGMULQTQVNONOOE-UHFFFAOYSA-N
MW286.24 g/mol
LogP1.31
Rot. Bonds4

About 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid

3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid (PubChem CID 79040867) has the molecular formula C10H7FN2O5S and a molecular weight of 286.24 g/mol. Its IUPAC name is 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid.

Molecular Properties

Compound Name3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid
PubChem CID79040867
Molecular FormulaC10H7FN2O5S
Molecular Weight286.24 g/mol
Exact Mass286.01
IUPAC Name3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid
SMILESO=C(O)c1ccc(S(=O)(=O)Nc2cnoc2)c(F)c1
InChIInChI=1S/C10H7FN2O5S/c11-8-3-6(10(14)15)1-2-9(8)19(16,17)13-7-4-12-18-5-7/h1-5,13H,(H,14,15)
InChIKeyGMULQTQVNONOOE-UHFFFAOYSA-N
XLogP1.31
TPSA109.50 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.24
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid?
The IUPAC name of 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid (CID 79040867) is 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid.
What is the SMILES notation for 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid?
The canonical SMILES for 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid is O=C(O)c1ccc(S(=O)(=O)Nc2cnoc2)c(F)c1.
What is the InChIKey of 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid?
The InChIKey is GMULQTQVNONOOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2O5S/c11-8-3-6(10(14)15)1-2-9(8)19(16,17)13-7-4-12-18-5-7/h1-5,13H,(H,14,15).
What are the key properties of 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid?
3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid has a molecular weight of 286.24 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid is sourced from PubChem (CID 79040867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).