C10H7FN2O5S — CID 79040867
3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid (PubChem CID 79040867) has the molecular formula C10H7FN2O5S and a molecular weight of 286.24 g/mol. Its IUPAC name is 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid.
| Compound Name | 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 79040867 |
| Molecular Formula | C10H7FN2O5S |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 3-fluoro-4-(1,2-oxazol-4-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2cnoc2)c(F)c1 |
| InChI | InChI=1S/C10H7FN2O5S/c11-8-3-6(10(14)15)1-2-9(8)19(16,17)13-7-4-12-18-5-7/h1-5,13H,(H,14,15) |
| InChIKey | GMULQTQVNONOOE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |