C11H9FN2O4S2 — CID 79187066
3-fluoro-4-[(5-methyl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid (PubChem CID 79187066) has the molecular formula C11H9FN2O4S2 and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-fluoro-4-[(5-methyl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 3-fluoro-4-[(5-methyl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 79187066 |
| Molecular Formula | C11H9FN2O4S2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 3-fluoro-4-[(5-methyl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1cnc(NS(=O)(=O)c2ccc(C(=O)O)cc2F)s1 |
| InChI | InChI=1S/C11H9FN2O4S2/c1-6-5-13-11(19-6)14-20(17,18)9-3-2-7(10(15)16)4-8(9)12/h2-5H,1H3,(H,13,14)(H,15,16) |
| InChIKey | WTYMGXOGCZOAKE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |