C12H11FN2O4S2 — CID 79177691
4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]-3-fluorobenzoic acid (PubChem CID 79177691) has the molecular formula C12H11FN2O4S2 and a molecular weight of 330.36 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 79177691 |
| Molecular Formula | C12H11FN2O4S2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]-3-fluorobenzoic acid |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(C(=O)O)cc2F)sc1C |
| InChI | InChI=1S/C12H11FN2O4S2/c1-6-7(2)20-12(14-6)15-21(18,19)10-4-3-8(11(16)17)5-9(10)13/h3-5H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | ROHBYWNBCUUFMT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |