C11H10FN3O4S2 — CID 115589504
N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-fluoro-2-nitrobenzenesulfonamide (PubChem CID 115589504) has the molecular formula C11H10FN3O4S2 and a molecular weight of 331.35 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-fluoro-2-nitrobenzenesulfonamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-fluoro-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115589504 |
| Molecular Formula | C11H10FN3O4S2 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-3-fluoro-2-nitrobenzenesulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2cccc(F)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C11H10FN3O4S2/c1-6-7(2)20-11(13-6)14-21(18,19)9-5-3-4-8(12)10(9)15(16)17/h3-5H,1-2H3,(H,13,14) |
| InChIKey | PWAZTSQZBQPQMD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|