C9H8ClN3O4S3 — CID 80741638
5-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-nitrothiophene-2-sulfonamide (PubChem CID 80741638) has the molecular formula C9H8ClN3O4S3 and a molecular weight of 353.83 g/mol. Its IUPAC name is 5-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80741638 |
| Molecular Formula | C9H8ClN3O4S3 |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 5-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)sc1C |
| InChI | InChI=1S/C9H8ClN3O4S3/c1-4-5(2)18-9(11-4)12-20(16,17)7-3-6(13(14)15)8(10)19-7/h3H,1-2H3,(H,11,12) |
| InChIKey | NHOHZRHTPWQPPM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|