C13H17N3O2S2 — CID 61464070
5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,3-dimethylbenzenesulfonamide (PubChem CID 61464070) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,3-dimethylbenzenesulfonamide.
| Compound Name | 5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 61464070 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-amino-N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)cc(S(=O)(=O)Nc2nc(C)c(C)s2)c1C |
| InChI | InChI=1S/C13H17N3O2S2/c1-7-5-11(14)6-12(8(7)2)20(17,18)16-13-15-9(3)10(4)19-13/h5-6H,14H2,1-4H3,(H,15,16) |
| InChIKey | SWQDOKJCAFUYEE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|