4-(1,2-oxazol-4-ylamino)benzoic acid

C10H8N2O3 — CID 115023257

IUPAC4-(1,2-oxazol-4-ylamino)benzoic acid
SMILESO=C(O)c1ccc(Nc2cnoc2)cc1
InChIInChI=1S/C10H8N2O3/c13-10(14)7-1-3-8(4-2-7)12-9-5-11-15-6-9/h1-6,12H,(H,13,14)
InChIKeyJGHDPGPHDNGBNH-UHFFFAOYSA-N
MW204.19 g/mol
LogP2.12
Rot. Bonds3

About 4-(1,2-oxazol-4-ylamino)benzoic acid

4-(1,2-oxazol-4-ylamino)benzoic acid (PubChem CID 115023257) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 4-(1,2-oxazol-4-ylamino)benzoic acid.

Molecular Properties

Compound Name4-(1,2-oxazol-4-ylamino)benzoic acid
PubChem CID115023257
Molecular FormulaC10H8N2O3
Molecular Weight204.19 g/mol
Exact Mass204.05
IUPAC Name4-(1,2-oxazol-4-ylamino)benzoic acid
SMILESO=C(O)c1ccc(Nc2cnoc2)cc1
InChIInChI=1S/C10H8N2O3/c13-10(14)7-1-3-8(4-2-7)12-9-5-11-15-6-9/h1-6,12H,(H,13,14)
InChIKeyJGHDPGPHDNGBNH-UHFFFAOYSA-N
XLogP2.12
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 52.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(1,2-oxazol-4-ylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,2-oxazol-4-ylamino)benzoic acid?
The IUPAC name of 4-(1,2-oxazol-4-ylamino)benzoic acid (CID 115023257) is 4-(1,2-oxazol-4-ylamino)benzoic acid.
What is the SMILES notation for 4-(1,2-oxazol-4-ylamino)benzoic acid?
The canonical SMILES for 4-(1,2-oxazol-4-ylamino)benzoic acid is O=C(O)c1ccc(Nc2cnoc2)cc1.
What is the InChIKey of 4-(1,2-oxazol-4-ylamino)benzoic acid?
The InChIKey is JGHDPGPHDNGBNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c13-10(14)7-1-3-8(4-2-7)12-9-5-11-15-6-9/h1-6,12H,(H,13,14).
What are the key properties of 4-(1,2-oxazol-4-ylamino)benzoic acid?
4-(1,2-oxazol-4-ylamino)benzoic acid has a molecular weight of 204.19 g/mol, XLogP of 2.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-oxazol-4-ylamino)benzoic acid is sourced from PubChem (CID 115023257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).