C9H8FN3O3S — CID 55132808
2-amino-4-fluoro-N-(1,2-oxazol-4-yl)benzenesulfonamide (PubChem CID 55132808) has the molecular formula C9H8FN3O3S and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-(1,2-oxazol-4-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-fluoro-N-(1,2-oxazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 55132808 |
| Molecular Formula | C9H8FN3O3S |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-amino-4-fluoro-N-(1,2-oxazol-4-yl)benzenesulfonamide |
| SMILES | Nc1cc(F)ccc1S(=O)(=O)Nc1cnoc1 |
| InChI | InChI=1S/C9H8FN3O3S/c10-6-1-2-9(8(11)3-6)17(14,15)13-7-4-12-16-5-7/h1-5,13H,11H2 |
| InChIKey | HLHYIBGOKILDII-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|