C9H7ClFN3O3S — CID 62903482
5-amino-3-chloro-2-fluoro-N-(1,2-oxazol-4-yl)benzenesulfonamide (PubChem CID 62903482) has the molecular formula C9H7ClFN3O3S and a molecular weight of 291.69 g/mol. Its IUPAC name is 5-amino-3-chloro-2-fluoro-N-(1,2-oxazol-4-yl)benzenesulfonamide.
| Compound Name | 5-amino-3-chloro-2-fluoro-N-(1,2-oxazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 62903482 |
| Molecular Formula | C9H7ClFN3O3S |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 5-amino-3-chloro-2-fluoro-N-(1,2-oxazol-4-yl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)c(F)c(S(=O)(=O)Nc2cnoc2)c1 |
| InChI | InChI=1S/C9H7ClFN3O3S/c10-7-1-5(12)2-8(9(7)11)18(15,16)14-6-3-13-17-4-6/h1-4,14H,12H2 |
| InChIKey | CBSVQPFUUISOEJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|