C12H11BrClNO4S2 — CID 106426920
3-bromo-2-chloro-5-(2-prop-2-ynylsulfanylethylsulfamoyl)benzoic acid (PubChem CID 106426920) has the molecular formula C12H11BrClNO4S2 and a molecular weight of 412.71 g/mol. Its IUPAC name is 3-bromo-2-chloro-5-(2-prop-2-ynylsulfanylethylsulfamoyl)benzoic acid.
| Compound Name | 3-bromo-2-chloro-5-(2-prop-2-ynylsulfanylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 106426920 |
| Molecular Formula | C12H11BrClNO4S2 |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 410.90 |
| IUPAC Name | 3-bromo-2-chloro-5-(2-prop-2-ynylsulfanylethylsulfamoyl)benzoic acid |
| SMILES | C#CCSCCNS(=O)(=O)c1cc(Br)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H11BrClNO4S2/c1-2-4-20-5-3-15-21(18,19)8-6-9(12(16)17)11(14)10(13)7-8/h1,6-7,15H,3-5H2,(H,16,17) |
| InChIKey | CHZHQRCXMCHPBM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|