C12H12BrNO4S2 — CID 106426972
3-bromo-4-(2-prop-2-ynylsulfanylethylsulfamoyl)benzoic acid (PubChem CID 106426972) has the molecular formula C12H12BrNO4S2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 3-bromo-4-(2-prop-2-ynylsulfanylethylsulfamoyl)benzoic acid.
| Compound Name | 3-bromo-4-(2-prop-2-ynylsulfanylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 106426972 |
| Molecular Formula | C12H12BrNO4S2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | 3-bromo-4-(2-prop-2-ynylsulfanylethylsulfamoyl)benzoic acid |
| SMILES | C#CCSCCNS(=O)(=O)c1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C12H12BrNO4S2/c1-2-6-19-7-5-14-20(17,18)11-4-3-9(12(15)16)8-10(11)13/h1,3-4,8,14H,5-7H2,(H,15,16) |
| InChIKey | BELRRQOXVFBZKA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|