C10H10Cl2N2O5S — CID 43545481
3-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-2,5-dichlorobenzoic acid (PubChem CID 43545481) has the molecular formula C10H10Cl2N2O5S and a molecular weight of 341.17 g/mol. Its IUPAC name is 3-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-2,5-dichlorobenzoic acid.
| Compound Name | 3-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-2,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 43545481 |
| Molecular Formula | C10H10Cl2N2O5S |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 3-[(1-amino-1-oxopropan-2-yl)sulfamoyl]-2,5-dichlorobenzoic acid |
| SMILES | CC(NS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl)C(N)=O |
| InChI | InChI=1S/C10H10Cl2N2O5S/c1-4(9(13)15)14-20(18,19)7-3-5(11)2-6(8(7)12)10(16)17/h2-4,14H,1H3,(H2,13,15)(H,16,17) |
| InChIKey | HURLBMFAHDHGGI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |