C17H20N2O4S — CID 9219640
N-[4-(methylsulfamoyl)phenyl]-4-phenoxybutanamide (PubChem CID 9219640) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[4-(methylsulfamoyl)phenyl]-4-phenoxybutanamide.
| Compound Name | N-[4-(methylsulfamoyl)phenyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 9219640 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[4-(methylsulfamoyl)phenyl]-4-phenoxybutanamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)CCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-18-24(21,22)16-11-9-14(10-12-16)19-17(20)8-5-13-23-15-6-3-2-4-7-15/h2-4,6-7,9-12,18H,5,8,13H2,1H3,(H,19,20) |
| InChIKey | UPAVFRWEWHGXIV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|