C23H23FN2O5S — CID 4788551
N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-phenoxybutanamide (PubChem CID 4788551) has the molecular formula C23H23FN2O5S and a molecular weight of 458.51 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-phenoxybutanamide.
| Compound Name | N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 4788551 |
| Molecular Formula | C23H23FN2O5S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-phenoxybutanamide |
| SMILES | COc1ccc(NC(=O)CCCOc2ccccc2)cc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O5S/c1-30-22-14-11-18(25-23(27)8-5-15-31-19-6-3-2-4-7-19)16-21(22)26-32(28,29)20-12-9-17(24)10-13-20/h2-4,6-7,9-14,16,26H,5,8,15H2,1H3,(H,25,27) |
| InChIKey | ZTYMBFKGEDVHDD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|