C18H25N3O4 — CID 176654073
tert-butyl N-[4-[2-(3-amino-1,2-oxazol-5-yl)phenoxy]butyl]carbamate (PubChem CID 176654073) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(3-amino-1,2-oxazol-5-yl)phenoxy]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(3-amino-1,2-oxazol-5-yl)phenoxy]butyl]carbamate |
|---|---|
| PubChem CID | 176654073 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl N-[4-[2-(3-amino-1,2-oxazol-5-yl)phenoxy]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOc1ccccc1-c1cc(N)no1 |
| InChI | InChI=1S/C18H25N3O4/c1-18(2,3)24-17(22)20-10-6-7-11-23-14-9-5-4-8-13(14)15-12-16(19)21-25-15/h4-5,8-9,12H,6-7,10-11H2,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | OKIQXLQLTZDZMV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|