C25H35N5O2 — CID 67272743
tert-butyl N-[4-[(1-methylbenzimidazol-2-yl)methyl-[(3-methyl-2-pyridinyl)methyl]amino]butyl]carbamate (PubChem CID 67272743) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is tert-butyl N-[4-[(1-methylbenzimidazol-2-yl)methyl-[(3-methyl-2-pyridinyl)methyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1-methylbenzimidazol-2-yl)methyl-[(3-methyl-2-pyridinyl)methyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 67272743 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | tert-butyl N-[4-[(1-methylbenzimidazol-2-yl)methyl-[(3-methyl-2-pyridinyl)methyl]amino]butyl]carbamate |
| SMILES | Cc1cccnc1CN(CCCCNC(=O)OC(C)(C)C)Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C25H35N5O2/c1-19-11-10-15-26-21(19)17-30(16-9-8-14-27-24(31)32-25(2,3)4)18-23-28-20-12-6-7-13-22(20)29(23)5/h6-7,10-13,15H,8-9,14,16-18H2,1-5H3,(H,27,31) |
| InChIKey | BRICPLVMVBWAFR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|