C9H10ClN5 — CID 80857762
4-(4-chloropyrazol-1-yl)-N,6-dimethylpyrimidin-2-amine (PubChem CID 80857762) has the molecular formula C9H10ClN5 and a molecular weight of 223.67 g/mol. Its IUPAC name is 4-(4-chloropyrazol-1-yl)-N,6-dimethylpyrimidin-2-amine.
| Compound Name | 4-(4-chloropyrazol-1-yl)-N,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80857762 |
| Molecular Formula | C9H10ClN5 |
| Molecular Weight | 223.67 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-(4-chloropyrazol-1-yl)-N,6-dimethylpyrimidin-2-amine |
| SMILES | CNc1nc(C)cc(-n2cc(Cl)cn2)n1 |
| InChI | InChI=1S/C9H10ClN5/c1-6-3-8(14-9(11-2)13-6)15-5-7(10)4-12-15/h3-5H,1-2H3,(H,11,13,14) |
| InChIKey | CRBOQPHEMZSSIF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.67 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |